brendengutbrod brendengutbrod

03-05-2021
Biology

contestada

2. What is the mass of a space rock on Earth that has a weight of 16.8 N?

Respuesta :

AlphaEyad AlphaEyad

03-05-2021

Weight = mass x gravity
16.8 = mass x 10

I put 10 because gravity strength on earth is 10

Then rearrange

Mass = 16.8 / 10
Mass = 1.68 Kg

Answer Link

jadenmanuel13 jadenmanuel13

03-05-2021

The mass is 8018.62 depending on the area

Answer Link

Otras preguntas

What is 5+(123-113)divided by 10

Amy's computer needs to be repaired. The mechanic charges a flat $20 fee plus $30 per hour to fix it. Amy only wants to pay $150 in total. Write an inequality t

How are reactants converted to products in an elementary reaction?

What were two main reasons that the French established colonies in the America

On monday, mary had 23 bananas. On tuesday, her family ate half of them. On wednesday they ate half of the remaining bananas. If they continue each day, on whic

cosec(6b+pi/8)=sec(2b-pi/8)

If f(x) and rl (x) are inverse functions of each other and f(x) = 2х+5, what is rl (8) ? теnju оооо loo 3

If 22.5 metre of a uniform iron rod weight 85.5 kg , what will be the length of 22.8 kg of the same rod?

a photon has an energy of 1.10 x 10_-13 J. What is the photon's wavelenght? What type of electromagnetic radiation is it?

What is the sum? 3/8 +7/16 A) 5/12 B) 13/16 C) 7/8 D) 1 3/16