adamavalos2075 adamavalos2075
  • 01-06-2018
  • History
contestada

After world war ii, the united states aided ___ in its efforts to keep control of vietnam.

Respuesta :

titubsrat
titubsrat titubsrat
  • 04-06-2018
after www2  unatied state added FRANCE.
Answer Link

Otras preguntas

Why did the location of greek settlements allow contact with other civilazations
What is the Lewis dog diagram
When this reaction in equilibrium is heated, a red/brown color persists. what is true about this reaction? 2no2( g. ⇋ n2o4( g. brown/red colorless
How do Canada's new laws help native peoples preserve their culture? A. by finding them new homes on reserves B. by forcing schools to teach French Canadian his
round 56.4789 to the nearest thousandth
math is soooo hard. please help.
The length of the side opposite B measures __ units
What is 492.1 divided by 1.2
A jet plane traveling at 450 mph overtakes a propeller plane traveling at 250 mph that had a 3​-hour head start. How far from the starting point are the​ planes
cos(x/3)cos(x/3)=1/2(1+cos(2x/3))